933041-14-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H7BrN4.
The molecular weight of the compound is 299.13 g/mol.
The IUPAC name of the compound is 7-(3-bromophenyl)pyrazolo[1,5-a]pyrimidine-3-carbonitrile.
The InChI of the compound is InChI=1S/C13H7BrN4/c14-11-3-1-2-9(6-11)12-4-5-16-13-10(7-15)8-17-18(12)13/h1-6,8H.
The InChIKey of the compound is YKKBPEKMOUHSEU-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC(=C1)Br)C2=CC=NC3=C(C=NN23)C#N.
The CAS number of the compound is 933054-30-9.
The DSSTox Substance ID of the compound is DTXSID40675731.
The XLogP3 value of the compound is 2.
Yes, the compound is canonicalized.