CAS
93334-15-7 Purity
---
93334-15-7 Purity
---
![Hydrogen bis[2-[[5-(aminosulfonyl)-2-hydroxyphenyl]azo]-N-(2-chlorophenyl)-3-oxobutyramidato(2-)]cobaltate(1-)](https://resource.alfa-chemistry.com/structure/93338-23-9.gif)
Inquiry Basket
Cyclohexanecarboxylic-1-d1 acid
CAS
933-37-9
Catalog Number
ACM933379
Category
Other Products
Molecular Weight
129.18
Molecular Formula
C7H11DO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
CYCLOHEXANECARBOXYLIC-1-D1 ACID;Cyclohexanecarboxylic-D1 Acid
What is the molecular formula of Cyclohexanecarboxylic-1-d1 acid?
The molecular formula of Cyclohexanecarboxylic-1-d1 acid is C7H12O2.
What is the molecular weight of Cyclohexanecarboxylic-1-d1 acid?
The molecular weight of Cyclohexanecarboxylic-1-d1 acid is 129.17 g/mol.
What is the IUPAC name of Cyclohexanecarboxylic-1-d1 acid?
The IUPAC name of Cyclohexanecarboxylic-1-d1 acid is 1-deuteriocyclohexane-1-carboxylic acid.
What is the InChI of Cyclohexanecarboxylic-1-d1 acid?
The InChI of Cyclohexanecarboxylic-1-d1 acid is InChI=1S/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9)/i6D.
What is the InChIKey of Cyclohexanecarboxylic-1-d1 acid?
The InChIKey of Cyclohexanecarboxylic-1-d1 acid is NZNMSOFKMUBTKW-RAMDWTOOSA-N.
What is the Canonical SMILES of Cyclohexanecarboxylic-1-d1 acid?
The Canonical SMILES of Cyclohexanecarboxylic-1-d1 acid is C1CCC(CC1)C(=O)O.
What is the Isomeric SMILES of Cyclohexanecarboxylic-1-d1 acid?
The Isomeric SMILES of Cyclohexanecarboxylic-1-d1 acid is [2H]C1(CCCCC1)C(=O)O.
What is the XLogP3-AA value of Cyclohexanecarboxylic-1-d1 acid?
The XLogP3-AA value of Cyclohexanecarboxylic-1-d1 acid is 1.9.
How many hydrogen bond donor counts does Cyclohexanecarboxylic-1-d1 acid have?
Cyclohexanecarboxylic-1-d1 acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Cyclohexanecarboxylic-1-d1 acid have?
Cyclohexanecarboxylic-1-d1 acid has 2 hydrogen bond acceptor counts.
Recommended Products
![2H-Pyrazino[1,2-a]pyrazine,octahydro-2,8-dimethyl-(7ci)](https://resource.alfa-chemistry.com/structure/93336-80-2.gif)
