CAS
93323-67-2 Purity
---
93323-67-2 Purity
---
Inquiry Basket
3-Indolebutyric acid
CAS
933-32-4
Catalog Number
ACM933324
Category
Other Products
Molecular Formula
C12H13NO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of indole-3-butyric acid?
The molecular formula of indole-3-butyric acid is C12H13NO2.
What is the molecular weight of indole-3-butyric acid?
The molecular weight of indole-3-butyric acid is 203.24 g/mol.
What is the IUPAC name of indole-3-butyric acid?
The IUPAC name of indole-3-butyric acid is 4-(1H-indol-3-yl)butanoic acid.
What is the InChI of indole-3-butyric acid?
The InChI of indole-3-butyric acid is InChI=1S/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15).
What is the InChIKey of indole-3-butyric acid?
The InChIKey of indole-3-butyric acid is JTEDVYBZBROSJT-UHFFFAOYSA-N.
What is the Canonical SMILES of indole-3-butyric acid?
The Canonical SMILES of indole-3-butyric acid is C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O.
What is the CAS number of indole-3-butyric acid?
The CAS number of indole-3-butyric acid is 133-32-4.
What is the ChEBI ID of indole-3-butyric acid?
The ChEBI ID of indole-3-butyric acid is CHEBI:582878.
What is the XLogP3 value of indole-3-butyric acid?
The XLogP3 value of indole-3-butyric acid is 2.3.
What is the hydrogen bond donor count of indole-3-butyric acid?
The hydrogen bond donor count of indole-3-butyric acid is 2.
Recommended Products
