93288-23-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H17N3O.
The molecular weight of the compound is 219.28 g/mol.
The IUPAC name of the compound is (2-aminophenyl)-(4-methylpiperazin-1-yl)methanone.
The InChI of the compound is InChI=1S/C12H17N3O/c1-14-6-8-15(9-7-14)12(16)10-4-2-3-5-11(10)13/h2-5H,6-9,13H2,1H3.
The InChIKey of the compound is PEIXOOFVMXCCCT-UHFFFAOYSA-N.
The canonical SMILES of the compound is CN1CCN(CC1)C(=O)C2=CC=CC=C2N.
The CAS number of the compound is 93288-86-9.
The EC number of the compound is 878-967-0.
The XLogP3 value of the compound is 0.2.
Yes, the compound is canonicalized.