What is the molecular formula of Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine?
The molecular formula is C16H25NO2.
What is the molecular weight of Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine?
The molecular weight is 263.37 g/mol.
What is the IUPAC name of Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine?
The IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]cyclohexanamine.
What is the InChI of Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine?
The InChI is InChI=1S/C16H25NO2/c1-18-15-9-8-13(12-16(15)19-2)10-11-17-14-6-4-3-5-7-14/h8-9,12,14,17H,3-7,10-11H2,1-2H3.
What is the InChIKey of Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine?
The InChIKey is QYUUWFKPJWELGD-UHFFFAOYSA-N.
What is the Canonical SMILES of Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine?
The Canonical SMILES is COC1=C(C=C(C=C1)CCNC2CCCCC2)OC.
What is the CAS number of Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine?
The CAS number is 93285-86-0.
How many Hydrogen Bond Acceptor Count does Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine have?
It has 3 Hydrogen Bond Acceptor Count.
What is the Topological Polar Surface Area of Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine?
The Topological Polar Surface Area is 30.5 Ų.
Is Cyclohexyl-[2-(3,4-dimethoxy-phenyl)-ethyl]-amine a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.