What is the molecular formula of Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate?
The molecular formula is C13H16FNO2.
What is the molecular weight of Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate?
The molecular weight is 237.27 g/mol.
What is the IUPAC name of Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate?
The IUPAC name is benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate.
What is the InChI of Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate?
The InChI is InChI=1S/C13H16FNO2/c14-11-6-7-12(8-11)15-13(16)17-9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,15,16)/t11-,12+/m0/s1.
What is the InChIKey of Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate?
The InChIKey is NDVBOSIQTJVVNB-NWDGAFQWSA-N.
What is the canonical SMILES of Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate?
The canonical SMILES is C1CC(CC1NC(=O)OCC2=CC=CC=C2)F.
What is the isomeric SMILES of Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate?
The isomeric SMILES is C1C[C@@H](C[C@@H]1NC(=O)OCC2=CC=CC=C2)F.
What is the XLogP3-AA value of Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate?
The XLogP3-AA value is 2.8.
How many hydrogen bond donor counts does Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate have?
It has 1 hydrogen bond donor count.
How many rotatable bond counts does Benzyl N-[(1R,3S)-3-fluorocyclopentyl]carbamate have?
It has 4 rotatable bond counts.