CAS
93-25-4 Purity
ca. 98%
93-25-4 Purity
ca. 98%
![L-Phenylalanine,N-[(5-chloro-3,4-dihydro-8-hydroxy-3-methyl-1,4-dioxo-1H-2-benzopyran-7-yl)carbonyl]-,(R)-(9ci)](https://resource.alfa-chemistry.com/structure/93261-84-8.gif)
Inquiry Basket
2-Cyclohexylcyclopropanecarboxylic acid methyl ester
CAS
93257-18-2
Catalog Number
ACM93257182
Category
Other Products
Molecular Weight
182.26
Molecular Formula
C11H18O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Density
1.066
What is the molecular formula of the compound?
The molecular formula of the compound is C11H18O2.
What are the synonyms for the compound?
The synonyms for the compound are 93257-18-2, Methyl 2-cyclohexylcyclopropane-1-carboxylate, 2-CYCLOHEXYLCYCLOPROPANECARBOXYLIC ACID METHYL ESTER, and FT-0720799.
What is the molecular weight of the compound?
The molecular weight of the compound is 182.26 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 2-cyclohexylcyclopropane-1-carboxylate.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C11H18O2/c1-13-11(12)10-7-9(10)8-5-3-2-4-6-8/h8-10H,2-7H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is FTWXIVHWZYMFEP-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is COC(=O)C1CC1C2CCCCC2.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.2.
How many hydrogen bond donors does the compound have?
The compound has 0 hydrogen bond donors.
How many hydrogen bond acceptors does the compound have?
The compound has 2 hydrogen bond acceptors.
Recommended Products
![3-Hydroxy-4,7,7-trimethyl-bicyclo[2.2.1]heptane-1-carboxylic acid](https://resource.alfa-chemistry.com/structure/93257-31-9.gif)
CAS
93257-31-9 Purity
---
93257-31-9 Purity
---
