932033-57-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C16H23NO5.
The synonyms of the compound include Z-D-SER(TBU)-OME, 93204-37-6, methyl (2R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoate, Z-O-tert-butyl-D-serine methyl ester, and SCHEMBL344382.
The molecular weight of the compound is 309.36 g/mol.
The IUPAC name of the compound is methyl (2R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoate.
The InChI of the compound is InChI=1S/C16H23NO5/c1-16(2,3)22-11-13(14(18)20-4)17-15(19)21-10-12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3,(H,17,19)/t13-/m1/s1.
The InChIKey of the compound is UMAXPCYVVRYQNO-CYBMUJFWSA-N.
The canonical SMILES of the compound is CC(C)(C)OCC(C(=O)OC)NC(=O)OCC1=CC=CC=C1.
The XLogP3-AA value of the compound is 2.2.
Yes, the compound has a defined atom stereocenter count of 1.