What is the molecular formula of {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid?
The molecular formula is C10H13NO6S.
What is the synonym for {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid?
One of the synonyms is "2-[(3,4-dimethoxyphenyl)sulfonylamino]acetic acid."
What is the molecular weight of {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid?
The molecular weight is 275.28 g/mol.
When was {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid created?
It was created on July 9, 2005.
What is the IUPAC name of {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid?
The IUPAC name is 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetic acid.
Provide the InChI of {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid.
The InChI is InChI=1S/C10H13NO6S/c1-16-8-4-3-7(5-9(8)17-2)18(14,15)11-6-10(12)13/h3-5,11H,6H2,1-2H3,(H,12,13).
What is the InChIKey of {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid?
The InChIKey is FMMNLVAUUSTYQG-UHFFFAOYSA-N.
Provide the canonical SMILES of {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid.
The canonical SMILES is COC1=C(C=C(C=C1)S(=O)(=O)NCC(=O)O)OC.
How many hydrogen bond donor counts does {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid have?
It has 2 hydrogen bond donor counts.
Is {[(3,4-Dimethoxyphenyl)sulfonyl]amino}acetic acid a canonicalized compound?
Yes, it is a canonicalized compound.