93101-70-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C18H25ClNO3.
The IUPAC name of the compound is (1-Methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)methyl2-hydroxy-3-methyl-2-phenylbutanoate chloride.
The molecular weight of the compound is 338.8 g/mol.
The InChI key of the compound is XUJGQKXNYMRRAN-UHFFFAOYSA-M.
The canonical SMILES of the compound is CC(C)C(C1=CC=CC=C1)(C(=O)OCC2=CCN(CC2)C)O.[Cl-].
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
The compound has 6 rotatable bond counts.
The topological polar surface area of the compound is 49.8?2.
Yes, the compound is canonicalized.