What is the molecular formula of 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one?
The molecular formula is C13H18N4O3.
What is the PubChem CID of 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one?
The PubChem CID is 53664896.
What is the IUPAC name of 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one?
The IUPAC name is 3,7-dimethyl-6-(5-oxohexoxy)purin-2-one.
What is the InChI of 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one?
The InChI is InChI=1S/C13H18N4O3/c1-9(18)6-4-5-7-20-12-10-11(14-8-16(10)2)17(3)13(19)15-12/h8H,4-7H2,1-3H3.
What is the InChIKey of 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one?
The InChIKey is AVWIQTQAJMTMIH-UHFFFAOYSA-N.
What is the molecular weight of 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one?
The molecular weight is 278.31 g/mol.
What is the XLogP3-AA value of 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one?
The XLogP3-AA value is 0.4.
How many hydrogen bond donor count does 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one have?
It has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one have?
It has 4 hydrogen bond acceptor count.
How many rotatable bond count does 3,7-Dihydro-3,7-dimethyl-6-[(5-oxohexyl)oxy]-2H-purin-2-one have?
It has 6 rotatable bond count.