What is the molecular formula of tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate?
The molecular formula is C17H24BrNO3.
When was tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate created?
It was created on February 29, 2008.
What is the IUPAC name of tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate?
The IUPAC name is tert-butyl 4-[(4-bromophenyl)methoxy]piperidine-1-carboxylate.
What is the InChI of tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate?
The InChI is InChI=1S/C17H24BrNO3/c1-17(2,3)22-16(20)19-10-8-15(9-11-19)21-12-13-4-6-14(18)7-5-13/h4-7,15H,8-12H2,1-3H3
What is the Canonical SMILES of tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate?
The Canonical SMILES is CC(C)(C)OC(=O)N1CCC(CC1)OCC2=CC=C(C=C2)Br
What is the molecular weight of tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate?
The molecular weight is 370.3 g/mol.
How many hydrogen bond acceptors does tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate have?
It has 3 hydrogen bond acceptors.
What is the exact mass of tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate?
The exact mass is 369.09396 g/mol.
How many rotatable bond counts does tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate have?
It has 5 rotatable bond counts.
Is tert-Butyl 4-(4-bromobenzyloxy)piperidine-1-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound.