92999-93-4 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H13BrO3.
The molecular weight of the compound is 285.13 g/mol.
The IUPAC name of the compound is 6-(3-bromophenyl)-6-oxohexanoic acid.
The Canonical SMILES of the compound is C1=CC(=CC(=C1)Br)C(=O)CCCCC(=O)O.
The XLogP3-AA value of the compound is 2.4.
The compound has a hydrogen bond donor count of 1.
The compound has a hydrogen bond acceptor count of 3.
The compound has a rotatable bond count of 6.
The topological polar surface area of the compound is 54.4 Ų.
Yes, the compound is canonicalized.