CAS
93249-67-3 Purity
---
93249-67-3 Purity
---
Inquiry Basket
2-Methoxyphenylacetic acid
CAS
93-25-4
Catalog Number
ACM93254
Category
Other Products
Molecular Weight
166.18
Molecular Formula
C9H10O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Methoxyphenylacetic acid?
The molecular formula of 2-Methoxyphenylacetic acid is C9H10O3.
What is the molecular weight of 2-Methoxyphenylacetic acid?
The molecular weight of 2-Methoxyphenylacetic acid is 166.17 g/mol.
What is the IUPAC Name of 2-Methoxyphenylacetic acid?
The IUPAC Name of 2-Methoxyphenylacetic acid is 2-(2-methoxyphenyl)acetic acid.
What is the InChI of 2-Methoxyphenylacetic acid?
The InChI of 2-Methoxyphenylacetic acid is InChI=1S/C9H10O3/c1-12-8-5-3-2-4-7(8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11).
What is the InChIKey of 2-Methoxyphenylacetic acid?
The InChIKey of 2-Methoxyphenylacetic acid is IVEWTCACRDEAOB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methoxyphenylacetic acid?
The canonical SMILES of 2-Methoxyphenylacetic acid is COC1=CC=CC=C1CC(=O)O.
What is the CAS number of 2-Methoxyphenylacetic acid?
The CAS number of 2-Methoxyphenylacetic acid is 93-25-4.
What is the XLogP3 value of 2-Methoxyphenylacetic acid?
The XLogP3 value of 2-Methoxyphenylacetic acid is 1.5.
What is the hydrogen bond donor count of 2-Methoxyphenylacetic acid?
The hydrogen bond donor count of 2-Methoxyphenylacetic acid is 1.
Recommended Products
CAS
93250-97-6 Purity
---
93250-97-6 Purity
---
