6-Aminonaphthalene-2-sulphonic acid

CAS

93-00-5

Catalog Number

ACM93005

Category

Other Products

Molecular Weight

223.25

Molecular Formula

C₁₀H₉NO₃S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of 6-aminonaphthalene-2-sulfonic acid?

The molecular formula of 6-aminonaphthalene-2-sulfonic acid is C10H9NO3S.

What is the molecular weight of 6-aminonaphthalene-2-sulfonic acid?

The molecular weight of 6-aminonaphthalene-2-sulfonic acid is 223.25 g/mol.

What is the IUPAC name of 6-aminonaphthalene-2-sulfonic acid?

The IUPAC name of 6-aminonaphthalene-2-sulfonic acid is 6-aminonaphthalene-2-sulfonic acid.

What is the InChIKey of 6-aminonaphthalene-2-sulfonic acid?

The InChIKey of 6-aminonaphthalene-2-sulfonic acid is SEMRCUIXRUXGJX-UHFFFAOYSA-N.

What is the canonical SMILES of 6-aminonaphthalene-2-sulfonic acid?

The canonical SMILES of 6-aminonaphthalene-2-sulfonic acid is C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C=C1N.

What is the CAS number of 6-aminonaphthalene-2-sulfonic acid?

The CAS number of 6-aminonaphthalene-2-sulfonic acid is 93-00-5.

What is the XLogP3 value of 6-aminonaphthalene-2-sulfonic acid?

The XLogP3 value of 6-aminonaphthalene-2-sulfonic acid is -0.1.

How many hydrogen bond donor counts does 6-aminonaphthalene-2-sulfonic acid have?

6-aminonaphthalene-2-sulfonic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 6-aminonaphthalene-2-sulfonic acid have?

6-aminonaphthalene-2-sulfonic acid has 4 hydrogen bond acceptor counts.

Upstream Synthesis Route 1

86-60-2

494-44-0
93-00-5

Reference: [1]Bayer; Duisberg
[Chemische Berichte, 1887, vol. 20, p. 1428]
Weinberg
[Chemische Berichte, 1887, vol. 20, p. 3354]
Current Patent Assignee: Bayer & Co. - DE42273, 1800, C
[Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 430][Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 430]
Current Patent Assignee: Bayer & Co. - DE42272, 1800, C
[Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 429][Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 429]