92956-06-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H10O5S.
The molecular weight of the compound is 266.27 g/mol.
The IUPAC name of the compound is 5-(benzenesulfonylmethyl)furan-2-carboxylic acid.
The InChI of the compound is InChI=1S/C12H10O5S/c13-12(14)11-7-6-9(17-11)8-18(15,16)10-4-2-1-3-5-10/h1-7H,8H2,(H,13,14).
The InChIKey of the compound is JAYCQRGXFORAAZ-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C(C=C1)S(=O)(=O)CC2=CC=C(O2)C(=O)O.
The CAS number of the compound is 92959-89-2.
The EC number of the compound is 819-404-0.
The ChEMBL ID of the compound is CHEMBL493435.
Yes, the compound is canonicalized.