CAS
92950-40-8 Purity
---
92950-40-8 Purity
---
Inquiry Basket
6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate
CAS
92952-73-3
Catalog Number
ACM92952733
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate?
The molecular formula is C24H25ClN2O3.
What is the molecular weight of 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate?
The molecular weight is 424.9 g/mol.
What are some synonyms for 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate?
Some synonyms include 92952-73-3, 6-Chloro-2-(4-(ethyl(2-hydroxyethyl)amino)phenyl)-1-methylbenz(cd)indolium acetate, and EINECS 296-673-5.
What is the InChIKey for 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate?
The InChIKey is GIAXHZDAQMKKKP-UHFFFAOYSA-M.
What is the canonical SMILES representation of 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate?
The canonical SMILES is CCN(CCO)C1=CC=C(C=C1)C2=[N+](C3=C4C2=CC=CC4=C(C=C3)Cl)C.CC(=O)[O-].
How many hydrogen bond donor counts does 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate?
The topological polar surface area is 66.6 Ų.
How many rotatable bond counts does 6-Chloro-2-[4-[ethyl(2-hydroxyethyl)amino]phenyl]-1-methylbenz[cd]indolium acetate have?
It has 5 rotatable bond counts.
Recommended Products
![1H,2H,3H,6H,7H,8H,9H-Cyclohexa[g]indole-2,3-dione](https://resource.alfa-chemistry.com/structure/92952-46-0.gif)
