92864-98-7 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C14H18O6.
The molecular weight of the compound is 282.29 g/mol.
The IUPAC name of the compound is 5-oxo-5-(2,4,5-trimethoxyphenyl)pentanoic acid.
The InChIKey of the compound is UBYMMMMAONUPTG-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=CC(=C(C=C1C(=O)CCCC(=O)O)OC)OC.
The XLogP3-AA value of the compound is 1.3.
The compound has 1 hydrogen bond donor count.
The compound has 6 hydrogen bond acceptor counts.
The exact mass and monoisotopic mass of the compound is 282.11033829 g/mol.
Yes, the compound is canonically bonded according to PubChem.