92829-83-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C29H29ClN2O.
The molecular weight of the compound is 457.0 g/mol.
The IUPAC name of the compound is 2-(3,3-diphenylpropylamino)-N,N-diphenylacetamide hydrochloride.
The InChI code of the compound is "InChI=1S/C29H28N2O.ClH/c32-29(31(26-17-9-3-10-18-26)27-19-11-4-12-20-27)23-30-22-21-28(24-13-5-1-6-14-24)25-15-7-2-8-16-25;/h1-20,28,30H,21-23H2;1H".
The InChIKey of the compound is "ZPXKZTFECIUDRQ-UHFFFAOYSA-N".
The canonical SMILES representation of the compound is "C1=CC=C(C=C1)C(CCNCC(=O)N(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl".
The compound has 2 hydrogen bond donor atoms.
The compound has 2 hydrogen bond acceptor atoms.
The compound has 9 rotatable bonds.
Yes, the compound is canonicalized.