928148-47-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C17H25ClO.
The molecular weight of the compound is 280.8 g/mol.
The IUPAC name of the compound is 3-chloro-1-(4-octylphenyl)propan-1-one.
The InChI of the compound is InChI=1S/C17H25ClO/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17(19)13-14-18/h9-12H,2-8,13-14H2,1H3.
The InChIKey of the compound is RRIVKRLKROHVNQ-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCCCCCCCC1=CC=C(C=C1)C(=O)CCCl.
The CAS number of the compound is 928165-59-7.
The XLogP3-AA value of the compound is 6.2.
There are 10 rotatable bonds in the compound.
Yes, the compound is canonicalized.