CAS
928118-00-7 Purity
96%
928118-00-7 Purity
96%
Inquiry Basket
(S)-2,6-Dimethyltyrosine methyl esterhydrochloride
CAS
928138-99-2
Catalog Number
ACM928138992
Category
Other Products
Molecular Formula
C12H18ClNO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
(S)-2,6-Dimethyltyrosine methyl ester hydrochloride
What is the molecular formula of (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
The molecular formula is C12H18ClNO3.
What is the molecular weight of (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
The molecular weight is 259.73 g/mol.
What is the IUPAC Name of (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
The IUPAC Name is methyl (2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoate.
What is the InChI of (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
The InChI is InChI=1S/C12H17NO3.ClH/c1-7-4-9(14)5-8(2)10(7)6-11(13)12(15)16-3;/h4-5,11,14H,6,13H2,1-3H3;1H/t11-/m0./s1.
What is the Canonical SMILES of (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
The Canonical SMILES is CC1=CC(=CC(=C1CC(C(=O)OC)N)C)O.Cl.
How many hydrogen bond donor counts are there in (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
There are 3 hydrogen bond donor counts.
What is the topological polar surface area of (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
The topological polar surface area is 72.6 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
How many rotatable bond counts are there in (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
There are 4 rotatable bond counts.
What is the Isotope Atom Count of (S)-2,6-Dimethyltyrosine methyl ester hydrochloride?
The Isotope Atom Count is 0.
Recommended Products
![6-Amino-2,3-dihydro-benzo[1,4]oxazine-4-carboxylic acid tert-butyl ester](https://resource.alfa-chemistry.com/structure/928118-00-7.gif)
![3,4-Dihydro-2H-benzo[1,4]oxazine-6-carbonitrile](https://resource.alfa-chemistry.com/structure/928118-07-4.gif)
