What is the molecular formula of n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine?
The molecular formula is C11H18N2.
When was n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine first created in PubChem?
It was created on July 31, 2007.
What is the molecular weight of n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine?
The molecular weight is 178.27 g/mol.
What are some synonyms for n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine?
Some synonyms include N1,N1-Dimethyl-1-(o-tolyl)ethane-1,2-diamine and N,N-dimethyl-1-(2-methylphenyl)ethane-1,2-diamine.
What are the InChI and InChIKey of n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine?
The InChI is InChI=1S/C11H18N2/c1-9-6-4-5-7-10(9)11(8-12)13(2)3/h4-7,11H,8,12H2,1-3H3 and the InChIKey is UIIGCYIMWMFPTM-UHFFFAOYSA-N.
How many hydrogen bond donor counts does n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine?
The XLogP3-AA value is 1.2.
What is the topological polar surface area of n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine?
The topological polar surface area is 29.3 Ų.
How many rotatable bond counts does n1,n1-Dimethyl-1-(2-methylphenyl)-1,2-ethanediamine have?
It has 3 rotatable bond counts.
Is the compound canonicalized according to PubChem?
Yes, the compound is canonicalized.