CAS
928658-23-5 Purity
---
928658-23-5 Purity
---
Inquiry Basket
2-Heptanone,6-methyl-
CAS
928-68-7
Catalog Number
ACM928687
Category
Other Products
Molecular Weight
128.212
Molecular Formula
C8H16O
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Heptanone?
The molecular formula of 2-Heptanone is C8H16O.
What are some synonyms for 2-Heptanone?
Some synonyms for 2-Heptanone include 6-Methylheptan-2-one, 6-METHYL-2-HEPTANONE, and 2-Methyl-6-heptanone.
What is the molecular weight of 2-Heptanone?
The molecular weight of 2-Heptanone is 128.21 g/mol.
In which natural products is 6-Methylheptan-2-one found?
6-Methylheptan-2-one is found in Aloe africana, Solanum lycopersicum, and other organisms.
What is the IUPAC name of 2-Heptanone?
The IUPAC name of 2-Heptanone is 6-methylheptan-2-one.
What is the InChI of 2-Heptanone?
The InChI of 2-Heptanone is InChI=1S/C8H16O/c1-7(2)5-4-6-8(3)9/h7H,4-6H2,1-3H3.
How many hydrogen bond acceptor counts does 2-Heptanone have?
2-Heptanone has one hydrogen bond acceptor count.
What is the topological polar surface area of 2-Heptanone?
The topological polar surface area of 2-Heptanone is 17.1 Å2.
How many rotatable bond counts does 2-Heptanone have?
2-Heptanone has four rotatable bond counts.
What is the exact mass of 2-Heptanone?
The exact mass of 2-Heptanone is 128.120115130 g/mol.
Recommended Products
