92777-75-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of the compound is 46738885.
The molecular formula of the compound is C9H5BrFN.
The molecular weight of the compound is 226.04 g/mol.
The IUPAC name of the compound is 6-bromo-8-fluoroquinoline.
The InChIKey of the compound is DDCOYWOYIUEOHQ-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC2=CC(=CC(=C2N=C1)F)Br.
The CAS number of the compound is 220513-46-2.
The XLogP3 value of the compound is 2.9.
The compound has 0 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.