CAS
92741-41-8 Purity
---
92741-41-8 Purity
---
Inquiry Basket
1H-Pyrazol-4-ol,3-amino-1-(1-methylethoxy)-
CAS
927417-52-5
Catalog Number
ACM927417525
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the PubChem CID of the compound?
The PubChem CID of the compound is 45121209.
What is the molecular formula of the compound?
The molecular formula of the compound is C6H11N3O2.
What are the synonyms of the compound?
The synonyms of the compound are 927417-52-5, 3-amino-1-isopropoxy-1h-pyrazol-4-ol, 1H-Pyrazol-4-ol, 3-amino-1-(1-methylethoxy)-, and SCHEMBL4912088.
What is the molecular weight of the compound?
The molecular weight of the compound is 157.17 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-amino-1-propan-2-yloxypyrazol-4-ol.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C6H11N3O2/c1-4(2)11-9-3-5(10)6(7)8-9/h3-4,10H,1-2H3,(H2,7,8).
What is the InChIKey of the compound?
The InChIKey of the compound is IPZAOHDPWYVXKD-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)ON1C=C(C(=N1)N)O.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.7.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
