What is the molecular formula of 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
The molecular formula is C13H11IN4O5.
What is the molecular weight of 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
The molecular weight is 430.15 g/mol.
What is the IUPAC name of 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
The IUPAC name is 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]pyridin-2-amine.
What is the InChI code of 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
The InChI code is InChI=1S/C13H11IN4O5/c14-10-7-11(18(21)22)12(15)16-13(10)23-6-5-8-1-3-9(4-2-8)17(19)20/h1-4,7H,5-6H2,(H2,15,16).
What is the Canonical SMILES of 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
The Canonical SMILES is C1=CC(=CC=C1CCOC2=C(C=C(C(=N2)N)[N+](=O)[O-])I)[N+](=O)[O-].
What is the XLogP3-AA value of 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
The XLogP3-AA value is 3.6.
How many hydrogen bond donor counts are in 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are in 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
There are 7 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
The topological polar surface area is 140 Ų.
Is the compound canonicalized for 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-?
Yes, the compound is canonicalized.