927181-97-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C20H19N5O4.
The synonyms of the compound are SCHEMBL4589978, DTXSID90705178, and CJQZQTMOXNAHNO-UHFFFAOYSA-N.
The molecular weight of the compound is 393.4 g/mol.
The IUPAC name of the compound is methyl 2-[(3-cyanobenzoyl)amino]-3-(3-methoxypropyl)imidazo[4,5-b]pyridine-6-carboxylate.
The canonical SMILES of the compound is COCCCN1C2=C(C=C(C=N2)C(=O)OC)N=C1NC(=O)C3=CC=CC(=C3)C#N.
The CAS number of the compound is 927186-04-7.
The XLogP3-AA value of the compound is 1.6.
The compound has 1 hydrogen bond donor count.
The compound has 7 hydrogen bond acceptor counts.
The compound has 8 rotatable bond counts.