92693-02-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C20H23BrN2O2.
The molecular weight is 403.3 g/mol.
Some synonyms include Ethyl 4-(4-(2-Bromobenzyl)piperazin-1-yl)benzoate, and Benzoic acid, 4-[4-[(2-bromophenyl)methyl]-1-piperazinyl]-, ethyl ester.
CCOC(=O)C1=CC=C(C=C1)N2CCN(CC2)CC3=CC=CC=C3Br
QCFBDQSHLKFOGJ-UHFFFAOYSA-N
The compound has 4 hydrogen bond acceptor counts.
The topological polar surface area is 32.8 Ų.
No, the compound does not have any defined atom stereocenters.
The compound has 6 rotatable bond counts.
Yes, the compound is canonicalized.