926921-59-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H11NO2S.
Some synonyms of the compound are 926921-63-3, 4-isocyanato-4-(thiophen-2-yl)oxane, and 4-isocyanato-4-(thien-2-yl)tetrahydro-2H-pyran.
The compound was created on 2008-02-29 and modified on 2023-12-30.
The IUPAC name of the compound is 4-isocyanato-4-thiophen-2-yloxane.
The InChI of the compound is InChI=1S/C10H11NO2S/c12-8-11-10(3-5-13-6-4-10)9-2-1-7-14-9/h1-2,7H,3-6H2.
The molecular weight of the compound is 209.27 g/mol.
The compound has 0 hydrogen bond donor counts.
The XLogP3-AA value of the compound is 2.6.
The topological polar surface area of the compound is 66.9 Ų.
Yes, the compound is canonicalized.