What is the molecular formula of Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
The molecular formula is C16H6F5NO2S.
What is the molecular weight of Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
The molecular weight is 371.3 g/mol.
What is the IUPAC name of Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
The IUPAC name is (2,3,4,5,6-pentafluorophenyl) 6-thiophen-2-ylpyridine-3-carboxylate.
What is the InChI of Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
The InChI is InChI=1S/C16H6F5NO2S/c17-10-11(18)13(20)15(14(21)12(10)19)24-16(23)7-3-4-8(22-6-7)9-2-1-5-25-9/h1-6H.
What is the InChIKey of Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
The InChIKey is UYAXHNWJTLZXTM-UHFFFAOYSA-N.
What is the Canonical SMILES of Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
The Canonical SMILES is C1=CSC(=C1)C2=NC=C(C=C2)C(=O)OC3=C(C(=C(C(=C3F)F)F)F)F.
What is the CAS number of Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
The CAS number is 926921-59-7.
How many hydrogen bond acceptors are in Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
There are 9 hydrogen bond acceptors.
What is the topological polar surface area of Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate?
The topological polar surface area is 67.4 Ų.
Is Pentafluorophenyl 2-thien-2-ylpyridine-5-carboxylate a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.