926-55-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is methyl 3-acetamidopyrazine-2-carboxylate.
The molecular formula of the compound is C8H9N3O3.
The molecular weight of the compound is 195.18 g/mol.
The InChI of the compound is InChI=1S/C8H9N3O3/c1-5(12)11-7-6(8(13)14-2)9-3-4-10-7/h3-4H,1-2H3,(H,10,11,12).
The InChIKey of the compound is HTBWRPNYWQZOBA-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(=O)NC1=NC=CN=C1C(=O)OC.
The CAS number of the compound is 92660-47-4.
The hydrogen bond donor count of the compound is 1.
The hydrogen bond acceptor count of the compound is 5.
Yes, the compound is canonicalized.