CAS
92647-73-9 Purity
---
92647-73-9 Purity
---
Inquiry Basket
Ethyl 2-[acetyl-[2-(dimethylamino)-2-oxoethyl]amino]benzoate
CAS
92648-99-2
Catalog Number
ACM92648992
Category
Other Products
Molecular Weight
292.33 g/mol
Molecular Formula
C15H20N2O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is ethyl 2-[acetyl-[2-(dimethylamino)-2-oxoethyl]amino]benzoate.
What is the molecular formula of the compound?
The molecular formula of the compound is C15H20N2O4.
What is the molecular weight of the compound?
The molecular weight of the compound is 292.33 g/mol.
What is the InChI for the compound?
The InChI for the compound is InChI=1S/C15H20N2O4/c1-5-21-15(20)12-8-6-7-9-13(12)17(11(2)18)10-14(19)16(3)4/h6-9H,5,10H2,1-4H3.
What is the InChIKey for the compound?
The InChIKey for the compound is XMJIDMRHFZMRSU-UHFFFAOYSA-N.
What is the Canonical SMILES for the compound?
The Canonical SMILES for the compound is CCOC(=O)C1=CC=CC=C1N(CC(=O)N(C)C)C(=O)C.
What is the CAS number of the compound?
The CAS number of the compound is 92648-99-2.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
Is the compound considered to have a defined atom stereocenter count?
No, the compound does not have a defined atom stereocenter count.
Recommended Products
CAS
92648-68-5 Purity
---
92648-68-5 Purity
---
