926196-67-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
Molecular formula of the compound is C11H18BrClN2O2.
The molecular weight of the compound is 325.63 g/mol.
The IUPAC name of the compound is (2-bromo-4,5-diethoxyphenyl)methylhydrazine;hydrochloride.
The Canonical SMILES of the compound is CCOC1=C(C=C(C(=C1)CNN)Br)OCC.Cl.
The InChIKey of the compound is VRJNFMLVGAVASD-UHFFFAOYSA-N.
There are 3 hydrogen bond donor counts in the compound.
The hydrogen bond acceptor count in the compound is 4.
There are 6 rotatable bond counts in the compound.
The topological polar surface area of the compound is 56.5 Å2.
Yes, the compound is canonicalized according to PubChem.