925672-88-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H12O3S.
The synonyms for the compound are 925674-54-0, 5-(4-Methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine, Thieno[3,4-b]-1,4-dioxin,2,3-dihydro-5-(4-methoxyphenyl)-, SCHEMBL17713608, and DTXSID50718840.
The molecular weight of the compound is 248.30 g/mol.
The IUPAC name of the compound is 5-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
The InChI of the compound is InChI=1S/C13H12O3S/c1-14-10-4-2-9(3-5-10)13-12-11(8-17-13)15-6-7-16-12/h2-5,8H,6-7H2,1H3.
The InChIKey of the compound is XUQGMFYCGYHWKU-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=CC=C(C=C1)C2=C3C(=CS2)OCCO3.
The CAS number of the compound is 925674-54-0.
The DSSTox Substance ID of the compound is DTXSID50718840.
Yes, the compound is considered canonicalized.