CAS
92546-72-0 Purity
96%
92546-72-0 Purity
96%
Inquiry Basket
2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid
CAS
92549-70-7
Catalog Number
ACM92549707
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid?
The molecular formula of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is C15H14O4.
What is the molecular weight of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid?
The molecular weight of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is 258.27 g/mol.
What is the IUPAC name of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid?
The IUPAC name of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is 2,6-dihydroxy-4-[(4-methylphenyl)methyl]benzoic acid.
What is the InChI key of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid?
The InChI key of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is QULOOOAMYKMCTN-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid?
The Canonical SMILES representation of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is CC1=CC=C(C=C1)CC2=CC(=C(C(=C2)O)C(=O)O)O.
What is the CAS number of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid?
The CAS number of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is 92549-70-7.
What is the XLogP3-AA value of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid?
The XLogP3-AA value of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is 4.1.
How many hydrogen bond donor counts does 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid have?
2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid has 3 hydrogen bond donor counts.
What is the topological polar surface area of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid?
The topological polar surface area of 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is 77.8 Ų.
Is 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid a canonicalized compound?
Yes, 2,6-Dihydroxy-4-(p-methylbenzyl)benzoic acid is a canonicalized compound.
Recommended Products
![1-Naphthalenecarboxaldehyde,2-[bis(2-chloroethyl)amino]-](https://resource.alfa-chemistry.com/structure/92553-57-6.gif)
CAS
92553-57-6 Purity
96%
92553-57-6 Purity
96%
