92541-43-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C26H29N5O4S.
The molecular weight of the compound is 507.6 g/mol.
The IUPAC name of the compound is 3,4,5-trimethoxy-N-[2-[3-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide.
The Canonical SMILES representation of the compound is COC1=CC(=CC(=C1OC)OC)C(=O)NC2=CC=CC=C2C3=CN4C(=CSC4=N3)CN5CCNCC5.
The InChIKey of the compound is SBEWVVLMFLTQFE-UHFFFAOYSA-N.
The compound has 2 hydrogen bond donor counts.
The compound has 8 hydrogen bond acceptor counts.
The XLogP3-AA value of the compound is 3.5.
The topological polar surface area of the compound is 118 Ų.
The compound has 8 rotatable bond counts.