CAS
925233-22-3 Purity
---
925233-22-3 Purity
---
Inquiry Basket
3-Pyrrolidinecarboxamide,1-(2-chloro-3-hydroxyphenyl)-
CAS
925233-25-6
Catalog Number
ACM925233256
Category
Other Products
Molecular Formula
C11H13ClN2O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C11H13ClN2O2.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-(2-chloro-3-hydroxyphenyl)pyrrolidine-3-carboxamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H13ClN2O2/c12-10-8(2-1-3-9(10)15)14-5-4-7(6-14)11(13)16/h1-3,7,15H,4-6H2,(H2,13,16).
What is the InChIKey of the compound?
The InChIKey of the compound is LYKYOJFPAKFVBZ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CN(CC1C(=O)N)C2=C(C(=CC=C2)O)Cl.
What is the molecular weight of the compound?
The molecular weight of the compound is 240.68 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.3.
How many hydrogen bond donor count does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor count does the compound have?
The compound has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 66.6 ?2.
Recommended Products
![Phenol,2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]-](https://resource.alfa-chemistry.com/structure/925233-23-4.gif)
CAS
925233-24-5 Purity
---
925233-24-5 Purity
---
![Phenol,2-chloro-3-[3-(methoxymethyl)-1-pyrrolidinyl]-](https://resource.alfa-chemistry.com/structure/925233-28-9.gif)
