92507-34-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3-Methylquinoline-2-carboxylic acid is C11H9NO2.
3-Methylquinoline-2-carboxylic acid was created in PubChem on February 8, 2007.
The molecular weight of 3-Methylquinoline-2-carboxylic acid is 187.19 g/mol.
The IUPAC name of 3-Methylquinoline-2-carboxylic acid is 3-methylquinoline-2-carboxylic acid.
The Canonical SMILES of 3-Methylquinoline-2-carboxylic acid is CC1=CC2=CC=CC=C2N=C1C(=O)O.
3-Methylquinoline-2-carboxylic acid has 1 hydrogen bond donor.
The topological polar surface area of 3-Methylquinoline-2-carboxylic acid is 50.2 Ų.
There are 14 heavy atoms present in 3-Methylquinoline-2-carboxylic acid.
No, 3-Methylquinoline-2-carboxylic acid does not have any defined atom stereocenters.
Yes, 3-Methylquinoline-2-carboxylic acid is considered a canonicalized compound in PubChem.