CAS
92573-39-2 Purity
96%
92573-39-2 Purity
96%
Inquiry Basket
(Z)-3-Methylpent-2-en-1-yl acetate
CAS
925-73-5
Catalog Number
ACM925735
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is [(Z)-3-methylpent-2-enyl] acetate.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H14O2.
What is the molecular weight of the compound?
The molecular weight of the compound is 142.20 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H14O2/c1-4-7(2)5-6-10-8(3)9/h5H,4,6H2,1-3H3/b7-5-.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCC(=CCOC(=O)C)C.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 4 rotatable bond counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 26.3 ?2.
Is the compound canonically bonded and in the defined form?
Yes, the compound is canonically bonded and in the defined form.
Recommended Products
![4-[Benzyl(ethyl)amino]benzenediazonium chloride](https://resource.alfa-chemistry.com/structure/92-57-9.gif)
