925689-54-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 6-Methyloctan-2-one is C9H18O.
The IUPAC name of 6-Methyloctan-2-one is 6-methyloctan-2-one.
The InChI of 6-Methyloctan-2-one is InChI=1S/C9H18O/c1-4-8(2)6-5-7-9(3)10/h8H,4-7H2,1-3H3.
There are 0 hydrogen bond donor counts in 6-Methyloctan-2-one.
The exact mass of 6-Methyloctan-2-one is 142.135765193 g/mol.
There are 5 rotatable bond counts in 6-Methyloctan-2-one.
Yes, 6-Methyloctan-2-one is considered a canonicalized compound.
The topological polar surface area of 6-Methyloctan-2-one is 17.1 Ų.
There are 0 defined atom stereocenter counts in 6-Methyloctan-2-one.
The molecular weight of 6-Methyloctan-2-one is 142.24 g/mol.