What is the molecular formula of 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium?
The molecular formula is C4H11N3NaO2.
When was 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium first created?
It was created on January 15, 2019.
What is the Canonical SMILES of 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium?
The Canonical SMILES is CCN(CC)[N+](=NO)[O-].[Na].
How many Hydrogen Bond Donor Count does 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium have?
It has 1 Hydrogen Bond Donor Count.
What is the CAS number of 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium?
The CAS number is 92382-74-6.
What is the Heavy Atom Count of 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium?
The Heavy Atom Count is 10.
Is the Compound Is Canonicalized for 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium?
Yes, the Compound Is Canonicalized.
What is the Formal Charge of 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium?
The Formal Charge is 0.
How many Covalently-Bonded Unit Count does 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium have?
It has 2 Covalently-Bonded Unit Count.
What is the Exact Mass of 1,1-Diethyl-2-hydroxy-2-nitroso-hydrazine sodium?
The Exact Mass is 156.07489588 g/mol.