CAS
923595-49-7 Purity
96%
923595-49-7 Purity
96%
Inquiry Basket
2-(2-Propynyl)-2-azaspiro(4.4)nonane-1,3-dione
CAS
92367-74-3
Catalog Number
ACM92367743
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C11H13NO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 191.23 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-prop-2-ynyl-2-azaspiro[4.4]nonane-1,3-dione.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H13NO2/c1-2-7-12-9(13)8-11(10(12)14)5-3-4-6-11/h1H,3-8H2.
What is the InChIKey of the compound?
The InChIKey of the compound is FAISTMNDMCILQH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C#CCN1C(=O)CC2(C1=O)CCCC2.
What is the CAS number of the compound?
The CAS number of the compound is 92367-74-3.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID20238984.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![6-Chloro-3-iodo-imidazo[1,2-b]pyridazine](https://resource.alfa-chemistry.com/structure/923595-49-7.gif)
![5-Chloro-3-iodopyrazolo[1,5-a]pyrimidine](https://resource.alfa-chemistry.com/structure/923595-58-8.gif)
CAS
92368-02-0 Purity
---
92368-02-0 Purity
---
