CAS
923241-54-7 Purity
---
923241-54-7 Purity
---
Inquiry Basket
3-Bromo-5-(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-pyridine
CAS
923276-49-7
Catalog Number
ACM923276497
Category
Other Products
Molecular Formula
C10H11BrN2O
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound with PubChem CID 15946455?
The IUPAC name of the compound is 2-(5-bromopyridin-3-yl)-4,4-dimethyl-5H-1,3-oxazole.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H11BrN2O/c1-10(2)6-14-9(13-10)7-3-8(11)5-12-4-7/h3-5H,6H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is VIJTTXXSRAHRJP-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC1(COC(=N1)C2=CC(=CN=C2)Br)C.
What is the molecular formula of the compound?
The molecular formula of the compound is C10H11BrN2O.
What is the molecular weight of the compound?
The molecular weight of the compound is 255.11 g/mol.
How many hydrogen bond acceptors does the compound have?
The compound has 3 hydrogen bond acceptors.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 34.5 Ų.
How many heavy atoms are present in the compound?
There are 14 heavy atoms in the compound.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![6-Cyclopropyl-3-methyl-isoxazolo[5,4-b]pyridine-4-carboxylic acid](https://resource.alfa-chemistry.com/structure/923258-65-5.gif)
CAS
923258-65-5 Purity
96%
923258-65-5 Purity
96%
![1H-Pyrazolo[4,3-d]pyrimidine,7-chloro-1-methyl-](https://resource.alfa-chemistry.com/structure/923282-39-7.gif)
