What is the molecular formula of 1-Allylcyclopropanesulfonic acid potassium salt?
The molecular formula is C6H9KO3S.
What is the molecular weight of 1-Allylcyclopropanesulfonic acid potassium salt?
The molecular weight is 200.30 g/mol.
What is the IUPAC name of 1-Allylcyclopropanesulfonic acid potassium salt?
The IUPAC name is potassium;1-prop-2-enylcyclopropane-1-sulfonate.
What is the InChI of 1-Allylcyclopropanesulfonic acid potassium salt?
The InChI is InChI=1S/C6H10O3S.K/c1-2-3-6(4-5-6)10(7,8)9;/h2H,1,3-5H2,(H,7,8,9);/q;+1/p-1.
What is the InChIKey of 1-Allylcyclopropanesulfonic acid potassium salt?
The InChIKey is JPOQAXGFRJANLY-UHFFFAOYSA-M.
What is the canonical SMILES of 1-Allylcyclopropanesulfonic acid potassium salt?
The canonical SMILES is C=CCC1(CC1)S(=O)(=O)[O-].[K+].
What is the CAS number of 1-Allylcyclopropanesulfonic acid potassium salt?
The CAS number is 923032-57-9.
What is the hydrogen bond donor count of 1-Allylcyclopropanesulfonic acid potassium salt?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of 1-Allylcyclopropanesulfonic acid potassium salt?
The hydrogen bond acceptor count is 3.
Is 1-Allylcyclopropanesulfonic acid potassium salt a canonicalized compound?
Yes, 1-Allylcyclopropanesulfonic acid potassium salt is canonicalized.