92292-25-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H12N2.
The molecular weight of the compound is 136.19 g/mol.
The IUPAC name of the compound is 1-(6-methylpyridin-3-yl)ethanamine.
The InChI of the compound is InChI=1S/C8H12N2/c1-6-3-4-8(5-10-6)7(2)9/h3-5,7H,9H2,1-2H3.
The InChIKey of the compound is GLTIIUKSLNSXKM-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=NC=C(C=C1)C(C)N.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 1 rotatable bond count.
Yes, the compound is canonicalized.