What is the molecular formula of 2-Ethyl-1-benzofuran-3-carbaldehyde oxime?
The molecular formula is C11H11NO2.
What is the molecular weight of 2-Ethyl-1-benzofuran-3-carbaldehyde oxime?
The molecular weight is 189.21 g/mol.
What is the IUPAC name of 2-Ethyl-1-benzofuran-3-carbaldehyde oxime?
The IUPAC name is (NE)-N-[(2-ethyl-1-benzofuran-3-yl)methylidene]hydroxylamine.
What is the InChI of 2-Ethyl-1-benzofuran-3-carbaldehyde oxime?
The InChI is InChI=1S/C11H11NO2/c1-2-10-9(7-12-13)8-5-3-4-6-11(8)14-10/h3-7,13H,2H2,1H3/b12-7+.
What is the InChIKey of 2-Ethyl-1-benzofuran-3-carbaldehyde oxime?
The InChIKey is BUKQODPEAREPPX-KPKJPENVSA-N.
What is the canonical SMILES of 2-Ethyl-1-benzofuran-3-carbaldehyde oxime?
The canonical SMILES is CCC1=C(C2=CC=CC=C2O1)C=NO.
What is the isomeric SMILES of 2-Ethyl-1-benzofuran-3-carbaldehyde oxime?
The isomeric SMILES is CCC1=C(C2=CC=CC=C2O1)/C=N/O.
What is the XLogP3-AA value of 2-Ethyl-1-benzofuran-3-carbaldehyde oxime?
The XLogP3-AA value is 2.9.
How many hydrogen bond donor counts does 2-Ethyl-1-benzofuran-3-carbaldehyde oxime have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Ethyl-1-benzofuran-3-carbaldehyde oxime have?
It has 3 hydrogen bond acceptor counts.