921620-15-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C18H8F3N5O.
The molecular weight of the compound is 367.3 g/mol.
The IUPAC name of the compound is 5-(4-cyanophenoxy)-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carbonitrile.
The InChI of the compound is InChI=1S/C18H8F3N5O/c19-18(20,21)13-3-1-2-12(8-13)16-24-17(15(10-23)25-26-16)27-14-6-4-11(9-22)5-7-14/h1-8H.
The InChIKey of the compound is XCZZSVAOIZPGEW-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=C(N=N2)C#N)OC3=CC=C(C=C3)C#N.
The CAS number of the compound is 921620-33-9.
The XLogP3-AA value of the compound is 3.4.
The compound has 0 hydrogen bond donor counts.
The compound has 9 hydrogen bond acceptor counts.