92161-46-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C18H9F3N4O3.
The molecular weight of the compound is 386.3 g/mol.
The IUPAC name of the compound is 5-(4-cyanophenoxy)-3-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-6-carboxylic acid.
The InChI of the compound is InChI=1S/C18H9F3N4O3/c19-18(20,21)12-3-1-2-11(8-12)15-23-16(14(17(26)27)24-25-15)28-13-6-4-10(9-22)5-7-13/h1-8H,(H,26,27).
The InChIKey of the compound is OMNPPFHKLNTKBS-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=C(N=N2)C(=O)O)OC3=CC=C(C=C3)C#N.
The XLogP3-AA value of the compound is 3.2.
The hydrogen bond donor count of the compound is 1.
The hydrogen bond acceptor count of the compound is 10.
The rotatable bond count of the compound is 4.