CAS
92093-23-7 Purity
---
92093-23-7 Purity
---
Inquiry Basket
1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile,4-chloro-1-[tris(1-methylethyl)silyl]-
CAS
920966-01-4
Catalog Number
ACM920966014
Category
Other Products
Molecular Formula
C17H24ClN3Si
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile, 4-chloro-1-[tris(1-methylethyl)silyl]-
What is the molecular formula of the compound?
The molecular formula of the compound is C17H24ClN3Si.
What is the molecular weight of the compound?
The molecular weight of the compound is 333.9 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-chloro-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridine-5-carbonitrile.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C17H24ClN3Si/c1-11(2)22(12(3)4,13(5)6)21-8-7-15-16(18)14(9-19)10-20-17(15)21/h7-8,10-13H,1-6H3.
What is the InChIKey of the compound?
The InChIKey of the compound is VEOCFQKNEORRRO-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C(C(=CN=C21)C#N)Cl.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 0.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 2.
How many rotatable bonds does the compound have?
The compound has 4 rotatable bonds.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![Ethanone,1-[5-[(dimethylamino)methyl]-3-isoxazolyl]-(9ci)](https://resource.alfa-chemistry.com/structure/92096-08-7.gif)
CAS
92096-08-7 Purity
---
92096-08-7 Purity
---
![4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile](https://resource.alfa-chemistry.com/structure/920965-86-2.gif)
CAS
920965-86-2 Purity
---
920965-86-2 Purity
---
![1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile, 4-chloro-](https://resource.alfa-chemistry.com/structure/920966-02-5.gif)
![1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 4-chloro-](https://resource.alfa-chemistry.com/structure/920966-03-6.gif)
