CAS
92704-41-1 Purity
---
92704-41-1 Purity
---
Inquiry Basket
3-Hydroxy-2-naphthoic acid
CAS
92-70-6
Catalog Number
ACM92706
Category
Other Products
Molecular Weight
188.18
Molecular Formula
C11H8O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Hydroxy-2-naphthoic acid?
The molecular formula of 3-Hydroxy-2-naphthoic acid is C11H8O3.
What is the molecular weight of 3-Hydroxy-2-naphthoic acid?
The molecular weight of 3-Hydroxy-2-naphthoic acid is 188.18 g/mol.
What is the IUPAC name of 3-Hydroxy-2-naphthoic acid?
The IUPAC name of 3-Hydroxy-2-naphthoic acid is 3-hydroxynaphthalene-2-carboxylic acid.
What is the canonical SMILES of 3-Hydroxy-2-naphthoic acid?
The canonical SMILES of 3-Hydroxy-2-naphthoic acid is C1=CC=C2C=C(C(=CC2=C1)C(=O)O).
What is the InChIKey of 3-Hydroxy-2-naphthoic acid?
The InChIKey of 3-Hydroxy-2-naphthoic acid is ALKYHXVLJMQRLQ-UHFFFAOYSA-N.
What is the CAS number of 3-Hydroxy-2-naphthoic acid?
The CAS number of 3-Hydroxy-2-naphthoic acid is 92-70-6.
What is the XLogP3-AA value of 3-Hydroxy-2-naphthoic acid?
The XLogP3-AA value of 3-Hydroxy-2-naphthoic acid is 2.9.
How many hydrogen bond donor counts does 3-Hydroxy-2-naphthoic acid have?
3-Hydroxy-2-naphthoic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Hydroxy-2-naphthoic acid have?
3-Hydroxy-2-naphthoic acid has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 3-Hydroxy-2-naphthoic acid have?
3-Hydroxy-2-naphthoic acid has 1 rotatable bond count.
Recommended Products
